C14H24IN3 — CID 155417997
6-iodo-3,6,10,10-tetramethyl-4,5,7,8,9,11-hexahydrocyclodeca[d]triazole (PubChem CID 155417997) has the molecular formula C14H24IN3 and a molecular weight of 361.27 g/mol. Its IUPAC name is 6-iodo-3,6,10,10-tetramethyl-4,5,7,8,9,11-hexahydrocyclodeca[d]triazole.
| Compound Name | 6-iodo-3,6,10,10-tetramethyl-4,5,7,8,9,11-hexahydrocyclodeca[d]triazole |
|---|---|
| PubChem CID | 155417997 |
| Molecular Formula | C14H24IN3 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 6-iodo-3,6,10,10-tetramethyl-4,5,7,8,9,11-hexahydrocyclodeca[d]triazole |
| SMILES | Cn1nnc2c1CCC(C)(I)CCCC(C)(C)C2 |
| InChI | InChI=1S/C14H24IN3/c1-13(2)7-5-8-14(3,15)9-6-12-11(10-13)16-17-18(12)4/h5-10H2,1-4H3 |
| InChIKey | ZWOXCUPKTCIPOZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|