C20H25N7O2S — CID 155418257
4-cyclopropyl-5-(6-methoxy-2-pyridinyl)-N-[3-(5-methoxypyrimidin-2-yl)butan-2-ylsulfanyl]-1,2,4-triazol-3-amine (PubChem CID 155418257) has the molecular formula C20H25N7O2S and a molecular weight of 427.53 g/mol. Its IUPAC name is 4-cyclopropyl-5-(6-methoxy-2-pyridinyl)-N-[3-(5-methoxypyrimidin-2-yl)butan-2-ylsulfanyl]-1,2,4-triazol-3-amine.
| Compound Name | 4-cyclopropyl-5-(6-methoxy-2-pyridinyl)-N-[3-(5-methoxypyrimidin-2-yl)butan-2-ylsulfanyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 155418257 |
| Molecular Formula | C20H25N7O2S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 4-cyclopropyl-5-(6-methoxy-2-pyridinyl)-N-[3-(5-methoxypyrimidin-2-yl)butan-2-ylsulfanyl]-1,2,4-triazol-3-amine |
| SMILES | COc1cnc(C(C)C(C)SNc2nnc(-c3cccc(OC)n3)n2C2CC2)nc1 |
| InChI | InChI=1S/C20H25N7O2S/c1-12(18-21-10-15(28-3)11-22-18)13(2)30-26-20-25-24-19(27(20)14-8-9-14)16-6-5-7-17(23-16)29-4/h5-7,10-14H,8-9H2,1-4H3,(H,25,26) |
| InChIKey | MXMUQNFTAIIHIE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|