C29H29F2N3O — CID 15541846
1,1-bis(4-fluorophenyl)-4-(4-quinolin-8-ylpiperazin-1-yl)butan-1-ol (PubChem CID 15541846) has the molecular formula C29H29F2N3O and a molecular weight of 473.57 g/mol. Its IUPAC name is 1,1-bis(4-fluorophenyl)-4-(4-quinolin-8-ylpiperazin-1-yl)butan-1-ol.
| Compound Name | 1,1-bis(4-fluorophenyl)-4-(4-quinolin-8-ylpiperazin-1-yl)butan-1-ol |
|---|---|
| PubChem CID | 15541846 |
| Molecular Formula | C29H29F2N3O |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 1,1-bis(4-fluorophenyl)-4-(4-quinolin-8-ylpiperazin-1-yl)butan-1-ol |
| SMILES | OC(CCCN1CCN(c2cccc3cccnc23)CC1)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C29H29F2N3O/c30-25-11-7-23(8-12-25)29(35,24-9-13-26(31)14-10-24)15-3-17-33-18-20-34(21-19-33)27-6-1-4-22-5-2-16-32-28(22)27/h1-2,4-14,16,35H,3,15,17-21H2 |
| InChIKey | PKYOSYBWWBPIKG-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |