C23H34N4O — CID 155418510
(Z)-2-(5-cyclobutyloxy-1,2-dimethyl-3,4-dihydro-2H-quinolin-6-yl)-3-piperidin-4-yliminoprop-1-en-1-amine (PubChem CID 155418510) has the molecular formula C23H34N4O and a molecular weight of 382.55 g/mol. Its IUPAC name is (Z)-2-(5-cyclobutyloxy-1,2-dimethyl-3,4-dihydro-2H-quinolin-6-yl)-3-piperidin-4-yliminoprop-1-en-1-amine.
| Compound Name | (Z)-2-(5-cyclobutyloxy-1,2-dimethyl-3,4-dihydro-2H-quinolin-6-yl)-3-piperidin-4-yliminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 155418510 |
| Molecular Formula | C23H34N4O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | (Z)-2-(5-cyclobutyloxy-1,2-dimethyl-3,4-dihydro-2H-quinolin-6-yl)-3-piperidin-4-yliminoprop-1-en-1-amine |
| SMILES | CC1CCc2c(ccc(C(=C/N)/C=N/C3CCNCC3)c2OC2CCC2)N1C |
| InChI | InChI=1S/C23H34N4O/c1-16-6-7-21-22(27(16)2)9-8-20(23(21)28-19-4-3-5-19)17(14-24)15-26-18-10-12-25-13-11-18/h8-9,14-16,18-19,25H,3-7,10-13,24H2,1-2H3/b17-14+,26-15+ |
| InChIKey | WXABKYLBJSADLJ-NGQJDVRGSA-N |
| XLogP | 3.51 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|