About 1,2-dimethyl-5-phenoxy-6-(1H-pyrazol-5-yl)-3,4-dihydro-2H-quinoline
1,2-dimethyl-5-phenoxy-6-(1H-pyrazol-5-yl)-3,4-dihydro-2H-quinoline (PubChem CID 155418659) has the molecular formula C20H21N3O
and a molecular weight of 319.41 g/mol. Its IUPAC name is 1,2-dimethyl-5-phenoxy-6-(1H-pyrazol-5-yl)-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | 1,2-dimethyl-5-phenoxy-6-(1H-pyrazol-5-yl)-3,4-dihydro-2H-quinoline |
| PubChem CID | 155418659 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 1,2-dimethyl-5-phenoxy-6-(1H-pyrazol-5-yl)-3,4-dihydro-2H-quinoline |
| SMILES | CC1CCc2c(ccc(-c3ccn[nH]3)c2Oc2ccccc2)N1C |
| InChI | InChI=1S/C20H21N3O/c1-14-8-9-17-19(23(14)2)11-10-16(18-12-13-21-22-18)20(17)24-15-6-4-3-5-7-15/h3-7,10-14H,8-9H2,1-2H3,(H,21,22) |
| InChIKey | YROXOZQWMAKXPU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-dimethyl-5-phenoxy-6-(1H-pyrazol-5-yl)-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-5-phenoxy-6-(1H-pyrazol-5-yl)-3,4-dihydro-2H-quinoline?
The IUPAC name of 1,2-dimethyl-5-phenoxy-6-(1H-pyrazol-5-yl)-3,4-dihydro-2H-quinoline (CID 155418659) is 1,2-dimethyl-5-phenoxy-6-(1H-pyrazol-5-yl)-3,4-dihydro-2H-quinoline.
What is the SMILES notation for 1,2-dimethyl-5-phenoxy-6-(1H-pyrazol-5-yl)-3,4-dihydro-2H-quinoline?
The canonical SMILES for 1,2-dimethyl-5-phenoxy-6-(1H-pyrazol-5-yl)-3,4-dihydro-2H-quinoline is CC1CCc2c(ccc(-c3ccn[nH]3)c2Oc2ccccc2)N1C.
What is the InChIKey of 1,2-dimethyl-5-phenoxy-6-(1H-pyrazol-5-yl)-3,4-dihydro-2H-quinoline?
The InChIKey is YROXOZQWMAKXPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O/c1-14-8-9-17-19(23(14)2)11-10-16(18-12-13-21-22-18)20(17)24-15-6-4-3-5-7-15/h3-7,10-14H,8-9H2,1-2H3,(H,21,22).
What are the key properties of 1,2-dimethyl-5-phenoxy-6-(1H-pyrazol-5-yl)-3,4-dihydro-2H-quinoline?
1,2-dimethyl-5-phenoxy-6-(1H-pyrazol-5-yl)-3,4-dihydro-2H-quinoline has a molecular weight of 319.41 g/mol, XLogP of 4.64, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-5-phenoxy-6-(1H-pyrazol-5-yl)-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 155418659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).