About (5R)-6-propan-2-yl-3,6-diazabicyclo[3.1.1]heptan-3-amine
(5R)-6-propan-2-yl-3,6-diazabicyclo[3.1.1]heptan-3-amine (PubChem CID 155418933) has the molecular formula C8H17N3
and a molecular weight of 155.25 g/mol. Its IUPAC name is (5R)-6-propan-2-yl-3,6-diazabicyclo[3.1.1]heptan-3-amine.
Molecular Properties
| Compound Name | (5R)-6-propan-2-yl-3,6-diazabicyclo[3.1.1]heptan-3-amine |
| PubChem CID | 155418933 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | (5R)-6-propan-2-yl-3,6-diazabicyclo[3.1.1]heptan-3-amine |
| SMILES | CC(C)N1C2C[C@@H]1CN(N)C2 |
| InChI | InChI=1S/C8H17N3/c1-6(2)11-7-3-8(11)5-10(9)4-7/h6-8H,3-5,9H2,1-2H3/t7-,8?/m1/s1 |
| InChIKey | PQIHLABKMFREJG-GVHYBUMESA-N |
| XLogP | 0.03 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze (5R)-6-propan-2-yl-3,6-diazabicyclo[3.1.1]heptan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-6-propan-2-yl-3,6-diazabicyclo[3.1.1]heptan-3-amine?
The IUPAC name of (5R)-6-propan-2-yl-3,6-diazabicyclo[3.1.1]heptan-3-amine (CID 155418933) is (5R)-6-propan-2-yl-3,6-diazabicyclo[3.1.1]heptan-3-amine.
What is the SMILES notation for (5R)-6-propan-2-yl-3,6-diazabicyclo[3.1.1]heptan-3-amine?
The canonical SMILES for (5R)-6-propan-2-yl-3,6-diazabicyclo[3.1.1]heptan-3-amine is CC(C)N1C2C[C@@H]1CN(N)C2.
What is the InChIKey of (5R)-6-propan-2-yl-3,6-diazabicyclo[3.1.1]heptan-3-amine?
The InChIKey is PQIHLABKMFREJG-GVHYBUMESA-N. The full InChI is InChI=1S/C8H17N3/c1-6(2)11-7-3-8(11)5-10(9)4-7/h6-8H,3-5,9H2,1-2H3/t7-,8?/m1/s1.
What are the key properties of (5R)-6-propan-2-yl-3,6-diazabicyclo[3.1.1]heptan-3-amine?
(5R)-6-propan-2-yl-3,6-diazabicyclo[3.1.1]heptan-3-amine has a molecular weight of 155.25 g/mol, XLogP of 0.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-6-propan-2-yl-3,6-diazabicyclo[3.1.1]heptan-3-amine is sourced from PubChem (CID 155418933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).