C39H26N2O2S2 — CID 155419232
11-[4-(9,9-dimethylfluoren-2-yl)-2-nitrophenyl]-8,14-dithia-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene (PubChem CID 155419232) has the molecular formula C39H26N2O2S2 and a molecular weight of 618.78 g/mol. Its IUPAC name is 11-[4-(9,9-dimethylfluoren-2-yl)-2-nitrophenyl]-8,14-dithia-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene.
| Compound Name | 11-[4-(9,9-dimethylfluoren-2-yl)-2-nitrophenyl]-8,14-dithia-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene |
|---|---|
| PubChem CID | 155419232 |
| Molecular Formula | C39H26N2O2S2 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.14 |
| IUPAC Name | 11-[4-(9,9-dimethylfluoren-2-yl)-2-nitrophenyl]-8,14-dithia-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc(-c4cc5c6c(c4)Sc4ccccc4N6c4ccccc4S5)c([N+](=O)[O-])c3)cc21 |
| InChI | InChI=1S/C39H26N2O2S2/c1-39(2)29-10-4-3-9-27(29)28-18-16-23(19-30(28)39)24-15-17-26(33(20-24)41(42)43)25-21-36-38-37(22-25)45-35-14-8-6-12-32(35)40(38)31-11-5-7-13-34(31)44-36/h3-22H,1-2H3 |
| InChIKey | IGASNYHALRRVJK-UHFFFAOYSA-N |
| XLogP | 11.63 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|