About 3-ethyl-5-(9-ethyl-4,7,10-trimethylundecan-2-yl)oxypentan-1-amine
3-ethyl-5-(9-ethyl-4,7,10-trimethylundecan-2-yl)oxypentan-1-amine (PubChem CID 155419255) has the molecular formula C23H49NO
and a molecular weight of 355.65 g/mol. Its IUPAC name is 3-ethyl-5-(9-ethyl-4,7,10-trimethylundecan-2-yl)oxypentan-1-amine.
Molecular Properties
| Compound Name | 3-ethyl-5-(9-ethyl-4,7,10-trimethylundecan-2-yl)oxypentan-1-amine |
| PubChem CID | 155419255 |
| Molecular Formula | C23H49NO |
| Molecular Weight | 355.65 g/mol |
| Exact Mass | 355.38 |
| IUPAC Name | 3-ethyl-5-(9-ethyl-4,7,10-trimethylundecan-2-yl)oxypentan-1-amine |
| SMILES | CCC(CCN)CCOC(C)CC(C)CCC(C)CC(CC)C(C)C |
| InChI | InChI=1S/C23H49NO/c1-8-22(12-14-24)13-15-25-21(7)16-19(5)10-11-20(6)17-23(9-2)18(3)4/h18-23H,8-17,24H2,1-7H3 |
| InChIKey | PVXZBUUELZSENJ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.65 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-5-(9-ethyl-4,7,10-trimethylundecan-2-yl)oxypentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-(9-ethyl-4,7,10-trimethylundecan-2-yl)oxypentan-1-amine?
The IUPAC name of 3-ethyl-5-(9-ethyl-4,7,10-trimethylundecan-2-yl)oxypentan-1-amine (CID 155419255) is 3-ethyl-5-(9-ethyl-4,7,10-trimethylundecan-2-yl)oxypentan-1-amine.
What is the SMILES notation for 3-ethyl-5-(9-ethyl-4,7,10-trimethylundecan-2-yl)oxypentan-1-amine?
The canonical SMILES for 3-ethyl-5-(9-ethyl-4,7,10-trimethylundecan-2-yl)oxypentan-1-amine is CCC(CCN)CCOC(C)CC(C)CCC(C)CC(CC)C(C)C.
What is the InChIKey of 3-ethyl-5-(9-ethyl-4,7,10-trimethylundecan-2-yl)oxypentan-1-amine?
The InChIKey is PVXZBUUELZSENJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H49NO/c1-8-22(12-14-24)13-15-25-21(7)16-19(5)10-11-20(6)17-23(9-2)18(3)4/h18-23H,8-17,24H2,1-7H3.
What are the key properties of 3-ethyl-5-(9-ethyl-4,7,10-trimethylundecan-2-yl)oxypentan-1-amine?
3-ethyl-5-(9-ethyl-4,7,10-trimethylundecan-2-yl)oxypentan-1-amine has a molecular weight of 355.65 g/mol, XLogP of 6.67, 16 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-(9-ethyl-4,7,10-trimethylundecan-2-yl)oxypentan-1-amine is sourced from PubChem (CID 155419255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).