C17H22N2 — CID 155419368
(2E)-N-(1-cyclohexa-2,4-dien-1-ylethenyl)-2-ethenyl-N'-ethylpenta-2,4-dienimidamide (PubChem CID 155419368) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is (2E)-N-(1-cyclohexa-2,4-dien-1-ylethenyl)-2-ethenyl-N'-ethylpenta-2,4-dienimidamide.
| Compound Name | (2E)-N-(1-cyclohexa-2,4-dien-1-ylethenyl)-2-ethenyl-N'-ethylpenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 155419368 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | (2E)-N-(1-cyclohexa-2,4-dien-1-ylethenyl)-2-ethenyl-N'-ethylpenta-2,4-dienimidamide |
| SMILES | C=C/C=C(C=C)/C(=N\CC)NC(=C)C1C=CC=CC1 |
| InChI | InChI=1S/C17H22N2/c1-5-11-15(6-2)17(18-7-3)19-14(4)16-12-9-8-10-13-16/h5-6,8-12,16H,1-2,4,7,13H2,3H3,(H,18,19)/b15-11+ |
| InChIKey | BYWMXYGILAJLPX-RVDMUPIBSA-N |
| XLogP | 3.94 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|