C17H21N3O7 — CID 155420064
[(3R)-5-cyclopropyloxy-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate (PubChem CID 155420064) has the molecular formula C17H21N3O7 and a molecular weight of 379.37 g/mol. Its IUPAC name is [(3R)-5-cyclopropyloxy-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate.
| Compound Name | [(3R)-5-cyclopropyloxy-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 155420064 |
| Molecular Formula | C17H21N3O7 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | [(3R)-5-cyclopropyloxy-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
| SMILES | COC(=O)OCOc1c2n(ccc1=O)N[C@@H]1CC(OC3CC3)CCN1C2=O |
| InChI | InChI=1S/C17H21N3O7/c1-24-17(23)26-9-25-15-12(21)5-7-20-14(15)16(22)19-6-4-11(8-13(19)18-20)27-10-2-3-10/h5,7,10-11,13,18H,2-4,6,8-9H2,1H3/t11?,13-/m0/s1 |
| InChIKey | USSVRZOLSOETSM-YUZLPWPTSA-N |
| XLogP | 0.63 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|