About 1-(9-methyldodecyl)-1-[(9E,11E)-tetradeca-9,11-dienyl]hydrazine
1-(9-methyldodecyl)-1-[(9E,11E)-tetradeca-9,11-dienyl]hydrazine (PubChem CID 155420485) has the molecular formula C27H54N2
and a molecular weight of 406.74 g/mol. Its IUPAC name is 1-(9-methyldodecyl)-1-[(9E,11E)-tetradeca-9,11-dienyl]hydrazine.
Molecular Properties
| Compound Name | 1-(9-methyldodecyl)-1-[(9E,11E)-tetradeca-9,11-dienyl]hydrazine |
| PubChem CID | 155420485 |
| Molecular Formula | C27H54N2 |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 406.43 |
| IUPAC Name | 1-(9-methyldodecyl)-1-[(9E,11E)-tetradeca-9,11-dienyl]hydrazine |
| SMILES | CC/C=C/C=C/CCCCCCCCN(N)CCCCCCCCC(C)CCC |
| InChI | InChI=1S/C27H54N2/c1-4-6-7-8-9-10-11-12-13-15-18-21-25-29(28)26-22-19-16-14-17-20-24-27(3)23-5-2/h6-9,27H,4-5,10-26,28H2,1-3H3/b7-6+,9-8+ |
| InChIKey | HNIIUEBZGBTCGS-BLHCBFLLSA-N |
| XLogP | 8.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(9-methyldodecyl)-1-[(9E,11E)-tetradeca-9,11-dienyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(9-methyldodecyl)-1-[(9E,11E)-tetradeca-9,11-dienyl]hydrazine?
The IUPAC name of 1-(9-methyldodecyl)-1-[(9E,11E)-tetradeca-9,11-dienyl]hydrazine (CID 155420485) is 1-(9-methyldodecyl)-1-[(9E,11E)-tetradeca-9,11-dienyl]hydrazine.
What is the SMILES notation for 1-(9-methyldodecyl)-1-[(9E,11E)-tetradeca-9,11-dienyl]hydrazine?
The canonical SMILES for 1-(9-methyldodecyl)-1-[(9E,11E)-tetradeca-9,11-dienyl]hydrazine is CC/C=C/C=C/CCCCCCCCN(N)CCCCCCCCC(C)CCC.
What is the InChIKey of 1-(9-methyldodecyl)-1-[(9E,11E)-tetradeca-9,11-dienyl]hydrazine?
The InChIKey is HNIIUEBZGBTCGS-BLHCBFLLSA-N. The full InChI is InChI=1S/C27H54N2/c1-4-6-7-8-9-10-11-12-13-15-18-21-25-29(28)26-22-19-16-14-17-20-24-27(3)23-5-2/h6-9,27H,4-5,10-26,28H2,1-3H3/b7-6+,9-8+.
What are the key properties of 1-(9-methyldodecyl)-1-[(9E,11E)-tetradeca-9,11-dienyl]hydrazine?
1-(9-methyldodecyl)-1-[(9E,11E)-tetradeca-9,11-dienyl]hydrazine has a molecular weight of 406.74 g/mol, XLogP of 8.58, 22 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(9-methyldodecyl)-1-[(9E,11E)-tetradeca-9,11-dienyl]hydrazine is sourced from PubChem (CID 155420485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).