C22H24ClN5OS — CID 155420753
N-[3-[5-(8-azaspiro[4.5]decan-8-yl)imidazo[1,2-c]pyrimidin-8-yl]sulfanyl-2-chlorophenyl]formamide (PubChem CID 155420753) has the molecular formula C22H24ClN5OS and a molecular weight of 441.99 g/mol. Its IUPAC name is N-[3-[5-(8-azaspiro[4.5]decan-8-yl)imidazo[1,2-c]pyrimidin-8-yl]sulfanyl-2-chlorophenyl]formamide.
| Compound Name | N-[3-[5-(8-azaspiro[4.5]decan-8-yl)imidazo[1,2-c]pyrimidin-8-yl]sulfanyl-2-chlorophenyl]formamide |
|---|---|
| PubChem CID | 155420753 |
| Molecular Formula | C22H24ClN5OS |
| Molecular Weight | 441.99 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | N-[3-[5-(8-azaspiro[4.5]decan-8-yl)imidazo[1,2-c]pyrimidin-8-yl]sulfanyl-2-chlorophenyl]formamide |
| SMILES | O=CNc1cccc(Sc2cnc(N3CCC4(CCCC4)CC3)n3ccnc23)c1Cl |
| InChI | InChI=1S/C22H24ClN5OS/c23-19-16(26-15-29)4-3-5-17(19)30-18-14-25-21(28-13-10-24-20(18)28)27-11-8-22(9-12-27)6-1-2-7-22/h3-5,10,13-15H,1-2,6-9,11-12H2,(H,26,29) |
| InChIKey | QTVQFDGALTWLEV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.99 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|