C19H17Cl2N5O4 — CID 155421392
4-[3,5-dichloro-4-[(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)oxy]phenyl]-6-methyl-8-oxa-2,4,5-triazabicyclo[5.1.0]oct-5-en-3-one (PubChem CID 155421392) has the molecular formula C19H17Cl2N5O4 and a molecular weight of 450.28 g/mol. Its IUPAC name is 4-[3,5-dichloro-4-[(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)oxy]phenyl]-6-methyl-8-oxa-2,4,5-triazabicyclo[5.1.0]oct-5-en-3-one.
| Compound Name | 4-[3,5-dichloro-4-[(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)oxy]phenyl]-6-methyl-8-oxa-2,4,5-triazabicyclo[5.1.0]oct-5-en-3-one |
|---|---|
| PubChem CID | 155421392 |
| Molecular Formula | C19H17Cl2N5O4 |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 4-[3,5-dichloro-4-[(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)oxy]phenyl]-6-methyl-8-oxa-2,4,5-triazabicyclo[5.1.0]oct-5-en-3-one |
| SMILES | CC1=NN(c2cc(Cl)c(Oc3n[nH]c(=O)c4c3CCCC4)c(Cl)c2)C(=O)NC2OC12 |
| InChI | InChI=1S/C19H17Cl2N5O4/c1-8-14-18(29-14)22-19(28)26(25-8)9-6-12(20)15(13(21)7-9)30-17-11-5-3-2-4-10(11)16(27)23-24-17/h6-7,14,18H,2-5H2,1H3,(H,22,28)(H,23,27) |
| InChIKey | CDGNVYCXZMPPPO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|