About 2-thiophen-2-yl-1,4-thiazinane 1-oxide
2-thiophen-2-yl-1,4-thiazinane 1-oxide (PubChem CID 155421484) has the molecular formula C8H11NOS2
and a molecular weight of 201.32 g/mol. Its IUPAC name is 2-thiophen-2-yl-1,4-thiazinane 1-oxide.
Molecular Properties
| Compound Name | 2-thiophen-2-yl-1,4-thiazinane 1-oxide |
| PubChem CID | 155421484 |
| Molecular Formula | C8H11NOS2 |
| Molecular Weight | 201.32 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | 2-thiophen-2-yl-1,4-thiazinane 1-oxide |
| SMILES | O=S1CCNCC1c1cccs1 |
| InChI | InChI=1S/C8H11NOS2/c10-12-5-3-9-6-8(12)7-2-1-4-11-7/h1-2,4,8-9H,3,5-6H2 |
| InChIKey | QRJCMHIRABTIAT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-thiophen-2-yl-1,4-thiazinane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-yl-1,4-thiazinane 1-oxide?
The IUPAC name of 2-thiophen-2-yl-1,4-thiazinane 1-oxide (CID 155421484) is 2-thiophen-2-yl-1,4-thiazinane 1-oxide.
What is the SMILES notation for 2-thiophen-2-yl-1,4-thiazinane 1-oxide?
The canonical SMILES for 2-thiophen-2-yl-1,4-thiazinane 1-oxide is O=S1CCNCC1c1cccs1.
What is the InChIKey of 2-thiophen-2-yl-1,4-thiazinane 1-oxide?
The InChIKey is QRJCMHIRABTIAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NOS2/c10-12-5-3-9-6-8(12)7-2-1-4-11-7/h1-2,4,8-9H,3,5-6H2.
What are the key properties of 2-thiophen-2-yl-1,4-thiazinane 1-oxide?
2-thiophen-2-yl-1,4-thiazinane 1-oxide has a molecular weight of 201.32 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-yl-1,4-thiazinane 1-oxide is sourced from PubChem (CID 155421484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).