C13H19NO4 — CID 155421541
[(3aS,6S,7E)-2-oxo-3a,4,5,6,9,9a-hexahydro-3H-cycloocta[b]furan-6-yl] N,N-dimethylcarbamate (PubChem CID 155421541) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is [(3aS,6S,7E)-2-oxo-3a,4,5,6,9,9a-hexahydro-3H-cycloocta[b]furan-6-yl] N,N-dimethylcarbamate.
| Compound Name | [(3aS,6S,7E)-2-oxo-3a,4,5,6,9,9a-hexahydro-3H-cycloocta[b]furan-6-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 155421541 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | [(3aS,6S,7E)-2-oxo-3a,4,5,6,9,9a-hexahydro-3H-cycloocta[b]furan-6-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)O[C@@H]1/C=C\CC2OC(=O)C[C@@H]2CC1 |
| InChI | InChI=1S/C13H19NO4/c1-14(2)13(16)17-10-4-3-5-11-9(6-7-10)8-12(15)18-11/h3-4,9-11H,5-8H2,1-2H3/b4-3-/t9-,10+,11?/m0/s1 |
| InChIKey | XHGWFGUMWLABNY-QLSOQWBWSA-N |
| XLogP | 1.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|