C17H21N7O3 — CID 155423006
cis-methyl (1R,2R)-2-[[6-[5-(azidomethyl)-1-methyltriazol-4-yl]-2-methyl-3-pyridinyl]oxymethyl]cyclobutane-1-carboxylate (PubChem CID 155423006) has the molecular formula C17H21N7O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is cis-methyl (1R,2R)-2-[[6-[5-(azidomethyl)-1-methyltriazol-4-yl]-2-methyl-3-pyridinyl]oxymethyl]cyclobutane-1-carboxylate.
| Compound Name | cis-methyl (1R,2R)-2-[[6-[5-(azidomethyl)-1-methyltriazol-4-yl]-2-methyl-3-pyridinyl]oxymethyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 155423006 |
| Molecular Formula | C17H21N7O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | cis-methyl (1R,2R)-2-[[6-[5-(azidomethyl)-1-methyltriazol-4-yl]-2-methyl-3-pyridinyl]oxymethyl]cyclobutane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@H]1COc1ccc(-c2nnn(C)c2CN=[N+]=[N-])nc1C |
| InChI | InChI=1S/C17H21N7O3/c1-10-15(27-9-11-4-5-12(11)17(25)26-3)7-6-13(20-10)16-14(8-19-22-18)24(2)23-21-16/h6-7,11-12H,4-5,8-9H2,1-3H3/t11-,12+/m0/s1 |
| InChIKey | HHMVQBFELKORLZ-NWDGAFQWSA-N |
| XLogP | 2.57 |
| TPSA | 127.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|