About 1-N,3-N-bis(4-tert-butylphenyl)-2-chloro-5-phenylbenzene-1,3-diamine
1-N,3-N-bis(4-tert-butylphenyl)-2-chloro-5-phenylbenzene-1,3-diamine (PubChem CID 155425008) has the molecular formula C32H35ClN2
and a molecular weight of 483.10 g/mol. Its IUPAC name is 1-N,3-N-bis(4-tert-butylphenyl)-2-chloro-5-phenylbenzene-1,3-diamine.
Molecular Properties
| Compound Name | 1-N,3-N-bis(4-tert-butylphenyl)-2-chloro-5-phenylbenzene-1,3-diamine |
| PubChem CID | 155425008 |
| Molecular Formula | C32H35ClN2 |
| Molecular Weight | 483.10 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 1-N,3-N-bis(4-tert-butylphenyl)-2-chloro-5-phenylbenzene-1,3-diamine |
| SMILES | CC(C)(C)c1ccc(Nc2cc(-c3ccccc3)cc(Nc3ccc(C(C)(C)C)cc3)c2Cl)cc1 |
| InChI | InChI=1S/C32H35ClN2/c1-31(2,3)24-12-16-26(17-13-24)34-28-20-23(22-10-8-7-9-11-22)21-29(30(28)33)35-27-18-14-25(15-19-27)32(4,5)6/h7-21,34-35H,1-6H3 |
| InChIKey | LEVDNQXOKCJYIX-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.10 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-N,3-N-bis(4-tert-butylphenyl)-2-chloro-5-phenylbenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,3-N-bis(4-tert-butylphenyl)-2-chloro-5-phenylbenzene-1,3-diamine?
The IUPAC name of 1-N,3-N-bis(4-tert-butylphenyl)-2-chloro-5-phenylbenzene-1,3-diamine (CID 155425008) is 1-N,3-N-bis(4-tert-butylphenyl)-2-chloro-5-phenylbenzene-1,3-diamine.
What is the SMILES notation for 1-N,3-N-bis(4-tert-butylphenyl)-2-chloro-5-phenylbenzene-1,3-diamine?
The canonical SMILES for 1-N,3-N-bis(4-tert-butylphenyl)-2-chloro-5-phenylbenzene-1,3-diamine is CC(C)(C)c1ccc(Nc2cc(-c3ccccc3)cc(Nc3ccc(C(C)(C)C)cc3)c2Cl)cc1.
What is the InChIKey of 1-N,3-N-bis(4-tert-butylphenyl)-2-chloro-5-phenylbenzene-1,3-diamine?
The InChIKey is LEVDNQXOKCJYIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H35ClN2/c1-31(2,3)24-12-16-26(17-13-24)34-28-20-23(22-10-8-7-9-11-22)21-29(30(28)33)35-27-18-14-25(15-19-27)32(4,5)6/h7-21,34-35H,1-6H3.
What are the key properties of 1-N,3-N-bis(4-tert-butylphenyl)-2-chloro-5-phenylbenzene-1,3-diamine?
1-N,3-N-bis(4-tert-butylphenyl)-2-chloro-5-phenylbenzene-1,3-diamine has a molecular weight of 483.10 g/mol, XLogP of 10.09, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,3-N-bis(4-tert-butylphenyl)-2-chloro-5-phenylbenzene-1,3-diamine is sourced from PubChem (CID 155425008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).