About (4E)-4-heptylidene-2,3-bis(trimethylsilyl)cyclopent-2-en-1-one
(4E)-4-heptylidene-2,3-bis(trimethylsilyl)cyclopent-2-en-1-one (PubChem CID 15542563) has the molecular formula C18H34OSi2
and a molecular weight of 322.64 g/mol. Its IUPAC name is (4E)-4-heptylidene-2,3-bis(trimethylsilyl)cyclopent-2-en-1-one.
Molecular Properties
| Compound Name | (4E)-4-heptylidene-2,3-bis(trimethylsilyl)cyclopent-2-en-1-one |
| PubChem CID | 15542563 |
| Molecular Formula | C18H34OSi2 |
| Molecular Weight | 322.64 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (4E)-4-heptylidene-2,3-bis(trimethylsilyl)cyclopent-2-en-1-one |
| SMILES | CCCCCC/C=C1\CC(=O)C([Si](C)(C)C)=C1[Si](C)(C)C |
| InChI | InChI=1S/C18H34OSi2/c1-8-9-10-11-12-13-15-14-16(19)18(21(5,6)7)17(15)20(2,3)4/h13H,8-12,14H2,1-7H3/b15-13+ |
| InChIKey | GJNWVUKQLPAQST-FYWRMAATSA-N |
| XLogP | 5.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.64 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-heptylidene-2,3-bis(trimethylsilyl)cyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-heptylidene-2,3-bis(trimethylsilyl)cyclopent-2-en-1-one?
The IUPAC name of (4E)-4-heptylidene-2,3-bis(trimethylsilyl)cyclopent-2-en-1-one (CID 15542563) is (4E)-4-heptylidene-2,3-bis(trimethylsilyl)cyclopent-2-en-1-one.
What is the SMILES notation for (4E)-4-heptylidene-2,3-bis(trimethylsilyl)cyclopent-2-en-1-one?
The canonical SMILES for (4E)-4-heptylidene-2,3-bis(trimethylsilyl)cyclopent-2-en-1-one is CCCCCC/C=C1\CC(=O)C([Si](C)(C)C)=C1[Si](C)(C)C.
What is the InChIKey of (4E)-4-heptylidene-2,3-bis(trimethylsilyl)cyclopent-2-en-1-one?
The InChIKey is GJNWVUKQLPAQST-FYWRMAATSA-N. The full InChI is InChI=1S/C18H34OSi2/c1-8-9-10-11-12-13-15-14-16(19)18(21(5,6)7)17(15)20(2,3)4/h13H,8-12,14H2,1-7H3/b15-13+.
What are the key properties of (4E)-4-heptylidene-2,3-bis(trimethylsilyl)cyclopent-2-en-1-one?
(4E)-4-heptylidene-2,3-bis(trimethylsilyl)cyclopent-2-en-1-one has a molecular weight of 322.64 g/mol, XLogP of 5.91, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-heptylidene-2,3-bis(trimethylsilyl)cyclopent-2-en-1-one is sourced from PubChem (CID 15542563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).