About 6-methyl-5H-thieno[2,3-c]pyrrole
6-methyl-5H-thieno[2,3-c]pyrrole (PubChem CID 155425693) has the molecular formula C7H7NS
and a molecular weight of 137.21 g/mol. Its IUPAC name is 6-methyl-5H-thieno[2,3-c]pyrrole.
Molecular Properties
| Compound Name | 6-methyl-5H-thieno[2,3-c]pyrrole |
| PubChem CID | 155425693 |
| Molecular Formula | C7H7NS |
| Molecular Weight | 137.21 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | 6-methyl-5H-thieno[2,3-c]pyrrole |
| SMILES | Cc1[nH]cc2ccsc12 |
| InChI | InChI=1S/C7H7NS/c1-5-7-6(4-8-5)2-3-9-7/h2-4,8H,1H3 |
| InChIKey | ASUOGYUIUNSLOP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.21 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methyl-5H-thieno[2,3-c]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5H-thieno[2,3-c]pyrrole?
The IUPAC name of 6-methyl-5H-thieno[2,3-c]pyrrole (CID 155425693) is 6-methyl-5H-thieno[2,3-c]pyrrole.
What is the SMILES notation for 6-methyl-5H-thieno[2,3-c]pyrrole?
The canonical SMILES for 6-methyl-5H-thieno[2,3-c]pyrrole is Cc1[nH]cc2ccsc12.
What is the InChIKey of 6-methyl-5H-thieno[2,3-c]pyrrole?
The InChIKey is ASUOGYUIUNSLOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NS/c1-5-7-6(4-8-5)2-3-9-7/h2-4,8H,1H3.
What are the key properties of 6-methyl-5H-thieno[2,3-c]pyrrole?
6-methyl-5H-thieno[2,3-c]pyrrole has a molecular weight of 137.21 g/mol, XLogP of 2.54, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5H-thieno[2,3-c]pyrrole is sourced from PubChem (CID 155425693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).