About (E)-4-[(2S,4S)-4-amino-2-carbamoylpyrrolidin-1-yl]-4-oxobut-2-enoyl fluoride
(E)-4-[(2S,4S)-4-amino-2-carbamoylpyrrolidin-1-yl]-4-oxobut-2-enoyl fluoride (PubChem CID 155426067) has the molecular formula C9H12FN3O3
and a molecular weight of 229.21 g/mol. Its IUPAC name is (E)-4-[(2S,4S)-4-amino-2-carbamoylpyrrolidin-1-yl]-4-oxobut-2-enoyl fluoride.
Molecular Properties
| Compound Name | (E)-4-[(2S,4S)-4-amino-2-carbamoylpyrrolidin-1-yl]-4-oxobut-2-enoyl fluoride |
| PubChem CID | 155426067 |
| Molecular Formula | C9H12FN3O3 |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | (E)-4-[(2S,4S)-4-amino-2-carbamoylpyrrolidin-1-yl]-4-oxobut-2-enoyl fluoride |
| SMILES | NC(=O)[C@@H]1C[C@H](N)CN1C(=O)/C=C/C(=O)F |
| InChI | InChI=1S/C9H12FN3O3/c10-7(14)1-2-8(15)13-4-5(11)3-6(13)9(12)16/h1-2,5-6H,3-4,11H2,(H2,12,16)/b2-1+/t5-,6-/m0/s1 |
| InChIKey | JBMURIDPJGOLBG-ZELZYMQXSA-N |
| XLogP | -1.55 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-[(2S,4S)-4-amino-2-carbamoylpyrrolidin-1-yl]-4-oxobut-2-enoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-[(2S,4S)-4-amino-2-carbamoylpyrrolidin-1-yl]-4-oxobut-2-enoyl fluoride?
The IUPAC name of (E)-4-[(2S,4S)-4-amino-2-carbamoylpyrrolidin-1-yl]-4-oxobut-2-enoyl fluoride (CID 155426067) is (E)-4-[(2S,4S)-4-amino-2-carbamoylpyrrolidin-1-yl]-4-oxobut-2-enoyl fluoride.
What is the SMILES notation for (E)-4-[(2S,4S)-4-amino-2-carbamoylpyrrolidin-1-yl]-4-oxobut-2-enoyl fluoride?
The canonical SMILES for (E)-4-[(2S,4S)-4-amino-2-carbamoylpyrrolidin-1-yl]-4-oxobut-2-enoyl fluoride is NC(=O)[C@@H]1C[C@H](N)CN1C(=O)/C=C/C(=O)F.
What is the InChIKey of (E)-4-[(2S,4S)-4-amino-2-carbamoylpyrrolidin-1-yl]-4-oxobut-2-enoyl fluoride?
The InChIKey is JBMURIDPJGOLBG-ZELZYMQXSA-N. The full InChI is InChI=1S/C9H12FN3O3/c10-7(14)1-2-8(15)13-4-5(11)3-6(13)9(12)16/h1-2,5-6H,3-4,11H2,(H2,12,16)/b2-1+/t5-,6-/m0/s1.
What are the key properties of (E)-4-[(2S,4S)-4-amino-2-carbamoylpyrrolidin-1-yl]-4-oxobut-2-enoyl fluoride?
(E)-4-[(2S,4S)-4-amino-2-carbamoylpyrrolidin-1-yl]-4-oxobut-2-enoyl fluoride has a molecular weight of 229.21 g/mol, XLogP of -1.55, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[(2S,4S)-4-amino-2-carbamoylpyrrolidin-1-yl]-4-oxobut-2-enoyl fluoride is sourced from PubChem (CID 155426067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).