C26H32N4O2 — CID 15542627
2-[4-[4-(2-oxo-1,3,4,5-tetrahydrobenzo[cd]indol-2a-yl)butyl]piperazin-1-yl]benzamide (PubChem CID 15542627) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 2-[4-[4-(2-oxo-1,3,4,5-tetrahydrobenzo[cd]indol-2a-yl)butyl]piperazin-1-yl]benzamide.
| Compound Name | 2-[4-[4-(2-oxo-1,3,4,5-tetrahydrobenzo[cd]indol-2a-yl)butyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 15542627 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 2-[4-[4-(2-oxo-1,3,4,5-tetrahydrobenzo[cd]indol-2a-yl)butyl]piperazin-1-yl]benzamide |
| SMILES | NC(=O)c1ccccc1N1CCN(CCCCC23CCCc4cccc(c42)NC3=O)CC1 |
| InChI | InChI=1S/C26H32N4O2/c27-24(31)20-9-1-2-11-22(20)30-17-15-29(16-18-30)14-4-3-12-26-13-6-8-19-7-5-10-21(23(19)26)28-25(26)32/h1-2,5,7,9-11H,3-4,6,8,12-18H2,(H2,27,31)(H,28,32) |
| InChIKey | MAWMLRNFZVOZSV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|