C16H20BrNO — CID 15542634
2a-(5-bromopentyl)-1,3,4,5-tetrahydrobenzo[cd]indol-2-one (PubChem CID 15542634) has the molecular formula C16H20BrNO and a molecular weight of 322.25 g/mol. Its IUPAC name is 2a-(5-bromopentyl)-1,3,4,5-tetrahydrobenzo[cd]indol-2-one.
| Compound Name | 2a-(5-bromopentyl)-1,3,4,5-tetrahydrobenzo[cd]indol-2-one |
|---|---|
| PubChem CID | 15542634 |
| Molecular Formula | C16H20BrNO |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2a-(5-bromopentyl)-1,3,4,5-tetrahydrobenzo[cd]indol-2-one |
| SMILES | O=C1Nc2cccc3c2C1(CCCCCBr)CCC3 |
| InChI | InChI=1S/C16H20BrNO/c17-11-3-1-2-9-16-10-5-7-12-6-4-8-13(14(12)16)18-15(16)19/h4,6,8H,1-3,5,7,9-11H2,(H,18,19) |
| InChIKey | OQLTYAOAZWNSAQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|