C11H7NO3S — CID 15542772
2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-4-one (PubChem CID 15542772) has the molecular formula C11H7NO3S and a molecular weight of 233.25 g/mol. Its IUPAC name is 2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-4-one.
| Compound Name | 2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-4-one |
|---|---|
| PubChem CID | 15542772 |
| Molecular Formula | C11H7NO3S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-4-one |
| SMILES | O=C1NS(=O)(=O)c2cccc3cccc1c23 |
| InChI | InChI=1S/C11H7NO3S/c13-11-8-5-1-3-7-4-2-6-9(10(7)8)16(14,15)12-11/h1-6H,(H,12,13) |
| InChIKey | JIBDPKQMYWLNGM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |