C18H36N2OS — CID 155427786
2-[1-(aminomethyl)cyclohexyl]-N-[3-(2-methylpentan-2-ylsulfanyl)propyl]acetamide (PubChem CID 155427786) has the molecular formula C18H36N2OS and a molecular weight of 328.57 g/mol. Its IUPAC name is 2-[1-(aminomethyl)cyclohexyl]-N-[3-(2-methylpentan-2-ylsulfanyl)propyl]acetamide.
| Compound Name | 2-[1-(aminomethyl)cyclohexyl]-N-[3-(2-methylpentan-2-ylsulfanyl)propyl]acetamide |
|---|---|
| PubChem CID | 155427786 |
| Molecular Formula | C18H36N2OS |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | 2-[1-(aminomethyl)cyclohexyl]-N-[3-(2-methylpentan-2-ylsulfanyl)propyl]acetamide |
| SMILES | CCCC(C)(C)SCCCNC(=O)CC1(CN)CCCCC1 |
| InChI | InChI=1S/C18H36N2OS/c1-4-9-17(2,3)22-13-8-12-20-16(21)14-18(15-19)10-6-5-7-11-18/h4-15,19H2,1-3H3,(H,20,21) |
| InChIKey | WXSCHWHIGIGFLH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|