C16H35N — CID 155428317
2,2,3,3,5,5,6,7-octamethyloctan-4-amine (PubChem CID 155428317) has the molecular formula C16H35N and a molecular weight of 241.46 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,7-octamethyloctan-4-amine.
| Compound Name | 2,2,3,3,5,5,6,7-octamethyloctan-4-amine |
|---|---|
| PubChem CID | 155428317 |
| Molecular Formula | C16H35N |
| Molecular Weight | 241.46 g/mol |
| Exact Mass | 241.28 |
| IUPAC Name | 2,2,3,3,5,5,6,7-octamethyloctan-4-amine |
| SMILES | CC(C)C(C)C(C)(C)C(N)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H35N/c1-11(2)12(3)15(7,8)13(17)16(9,10)14(4,5)6/h11-13H,17H2,1-10H3 |
| InChIKey | AVFNNTGCYMEXNC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |