About 3-[[cyclohexyl(methyl)sulfamoyl]amino]-4-methoxy-6-(pyrazol-1-ylmethyl)-1,2-benzoxazole
3-[[cyclohexyl(methyl)sulfamoyl]amino]-4-methoxy-6-(pyrazol-1-ylmethyl)-1,2-benzoxazole (PubChem CID 155428656) has the molecular formula C19H25N5O4S
and a molecular weight of 419.51 g/mol. Its IUPAC name is 3-[[cyclohexyl(methyl)sulfamoyl]amino]-4-methoxy-6-(pyrazol-1-ylmethyl)-1,2-benzoxazole.
Molecular Properties
| Compound Name | 3-[[cyclohexyl(methyl)sulfamoyl]amino]-4-methoxy-6-(pyrazol-1-ylmethyl)-1,2-benzoxazole |
| PubChem CID | 155428656 |
| Molecular Formula | C19H25N5O4S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 3-[[cyclohexyl(methyl)sulfamoyl]amino]-4-methoxy-6-(pyrazol-1-ylmethyl)-1,2-benzoxazole |
| SMILES | COc1cc(Cn2cccn2)cc2onc(NS(=O)(=O)N(C)C3CCCCC3)c12 |
| InChI | InChI=1S/C19H25N5O4S/c1-23(15-7-4-3-5-8-15)29(25,26)22-19-18-16(27-2)11-14(12-17(18)28-21-19)13-24-10-6-9-20-24/h6,9-12,15H,3-5,7-8,13H2,1-2H3,(H,21,22) |
| InChIKey | VRWKYOZVLGEXMF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[[cyclohexyl(methyl)sulfamoyl]amino]-4-methoxy-6-(pyrazol-1-ylmethyl)-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[cyclohexyl(methyl)sulfamoyl]amino]-4-methoxy-6-(pyrazol-1-ylmethyl)-1,2-benzoxazole?
The IUPAC name of 3-[[cyclohexyl(methyl)sulfamoyl]amino]-4-methoxy-6-(pyrazol-1-ylmethyl)-1,2-benzoxazole (CID 155428656) is 3-[[cyclohexyl(methyl)sulfamoyl]amino]-4-methoxy-6-(pyrazol-1-ylmethyl)-1,2-benzoxazole.
What is the SMILES notation for 3-[[cyclohexyl(methyl)sulfamoyl]amino]-4-methoxy-6-(pyrazol-1-ylmethyl)-1,2-benzoxazole?
The canonical SMILES for 3-[[cyclohexyl(methyl)sulfamoyl]amino]-4-methoxy-6-(pyrazol-1-ylmethyl)-1,2-benzoxazole is COc1cc(Cn2cccn2)cc2onc(NS(=O)(=O)N(C)C3CCCCC3)c12.
What is the InChIKey of 3-[[cyclohexyl(methyl)sulfamoyl]amino]-4-methoxy-6-(pyrazol-1-ylmethyl)-1,2-benzoxazole?
The InChIKey is VRWKYOZVLGEXMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N5O4S/c1-23(15-7-4-3-5-8-15)29(25,26)22-19-18-16(27-2)11-14(12-17(18)28-21-19)13-24-10-6-9-20-24/h6,9-12,15H,3-5,7-8,13H2,1-2H3,(H,21,22).
What are the key properties of 3-[[cyclohexyl(methyl)sulfamoyl]amino]-4-methoxy-6-(pyrazol-1-ylmethyl)-1,2-benzoxazole?
3-[[cyclohexyl(methyl)sulfamoyl]amino]-4-methoxy-6-(pyrazol-1-ylmethyl)-1,2-benzoxazole has a molecular weight of 419.51 g/mol, XLogP of 3.00, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[cyclohexyl(methyl)sulfamoyl]amino]-4-methoxy-6-(pyrazol-1-ylmethyl)-1,2-benzoxazole is sourced from PubChem (CID 155428656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).