About 2-[3-(4-bromo-2,5-difluoroanilino)sulfanyl-6-chloroindol-1-yl]ethanol
2-[3-(4-bromo-2,5-difluoroanilino)sulfanyl-6-chloroindol-1-yl]ethanol (PubChem CID 155428953) has the molecular formula C16H12BrClF2N2OS
and a molecular weight of 433.71 g/mol. Its IUPAC name is 2-[3-(4-bromo-2,5-difluoroanilino)sulfanyl-6-chloroindol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[3-(4-bromo-2,5-difluoroanilino)sulfanyl-6-chloroindol-1-yl]ethanol |
| PubChem CID | 155428953 |
| Molecular Formula | C16H12BrClF2N2OS |
| Molecular Weight | 433.71 g/mol |
| Exact Mass | 431.95 |
| IUPAC Name | 2-[3-(4-bromo-2,5-difluoroanilino)sulfanyl-6-chloroindol-1-yl]ethanol |
| SMILES | OCCn1cc(SNc2cc(F)c(Br)cc2F)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H12BrClF2N2OS/c17-11-6-13(20)14(7-12(11)19)21-24-16-8-22(3-4-23)15-5-9(18)1-2-10(15)16/h1-2,5-8,21,23H,3-4H2 |
| InChIKey | UHSTUCHVDCVQQO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.71 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(4-bromo-2,5-difluoroanilino)sulfanyl-6-chloroindol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4-bromo-2,5-difluoroanilino)sulfanyl-6-chloroindol-1-yl]ethanol?
The IUPAC name of 2-[3-(4-bromo-2,5-difluoroanilino)sulfanyl-6-chloroindol-1-yl]ethanol (CID 155428953) is 2-[3-(4-bromo-2,5-difluoroanilino)sulfanyl-6-chloroindol-1-yl]ethanol.
What is the SMILES notation for 2-[3-(4-bromo-2,5-difluoroanilino)sulfanyl-6-chloroindol-1-yl]ethanol?
The canonical SMILES for 2-[3-(4-bromo-2,5-difluoroanilino)sulfanyl-6-chloroindol-1-yl]ethanol is OCCn1cc(SNc2cc(F)c(Br)cc2F)c2ccc(Cl)cc21.
What is the InChIKey of 2-[3-(4-bromo-2,5-difluoroanilino)sulfanyl-6-chloroindol-1-yl]ethanol?
The InChIKey is UHSTUCHVDCVQQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrClF2N2OS/c17-11-6-13(20)14(7-12(11)19)21-24-16-8-22(3-4-23)15-5-9(18)1-2-10(15)16/h1-2,5-8,21,23H,3-4H2.
What are the key properties of 2-[3-(4-bromo-2,5-difluoroanilino)sulfanyl-6-chloroindol-1-yl]ethanol?
2-[3-(4-bromo-2,5-difluoroanilino)sulfanyl-6-chloroindol-1-yl]ethanol has a molecular weight of 433.71 g/mol, XLogP of 5.45, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4-bromo-2,5-difluoroanilino)sulfanyl-6-chloroindol-1-yl]ethanol is sourced from PubChem (CID 155428953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).