C17H14F4NO7P — CID 155429069
3-[(2S,4aR,6R,7aS)-2-oxo-2-[(2,4,6-trifluorophenyl)methoxy]-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoro-3H-pyridine-2,6-dione (PubChem CID 155429069) has the molecular formula C17H14F4NO7P and a molecular weight of 451.27 g/mol. Its IUPAC name is 3-[(2S,4aR,6R,7aS)-2-oxo-2-[(2,4,6-trifluorophenyl)methoxy]-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoro-3H-pyridine-2,6-dione.
| Compound Name | 3-[(2S,4aR,6R,7aS)-2-oxo-2-[(2,4,6-trifluorophenyl)methoxy]-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoro-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 155429069 |
| Molecular Formula | C17H14F4NO7P |
| Molecular Weight | 451.27 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 3-[(2S,4aR,6R,7aS)-2-oxo-2-[(2,4,6-trifluorophenyl)methoxy]-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoro-3H-pyridine-2,6-dione |
| SMILES | O=C1NC(=O)C([C@H]2C[C@@H]3O[P@@](=O)(OCc4c(F)cc(F)cc4F)OC[C@H]3O2)C=C1F |
| InChI | InChI=1S/C17H14F4NO7P/c18-7-1-10(19)9(11(20)2-7)5-26-30(25)27-6-15-14(29-30)4-13(28-15)8-3-12(21)17(24)22-16(8)23/h1-3,8,13-15H,4-6H2,(H,22,23,24)/t8?,13-,14+,15-,30+/m1/s1 |
| InChIKey | BPDUPVCENWEUOE-STUOBYMJSA-N |
| XLogP | 2.43 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|