C36H25F8NO6 — CID 155429173
2,2,3,3-tetrafluoropropyl 2-[9-ethyl-6-[2-(2,2,3,3-tetrafluoropropoxycarbonyl)benzoyl]carbazole-3-carbonyl]benzoate (PubChem CID 155429173) has the molecular formula C36H25F8NO6 and a molecular weight of 719.58 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 2-[9-ethyl-6-[2-(2,2,3,3-tetrafluoropropoxycarbonyl)benzoyl]carbazole-3-carbonyl]benzoate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 2-[9-ethyl-6-[2-(2,2,3,3-tetrafluoropropoxycarbonyl)benzoyl]carbazole-3-carbonyl]benzoate |
|---|---|
| PubChem CID | 155429173 |
| Molecular Formula | C36H25F8NO6 |
| Molecular Weight | 719.58 g/mol |
| Exact Mass | 719.16 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 2-[9-ethyl-6-[2-(2,2,3,3-tetrafluoropropoxycarbonyl)benzoyl]carbazole-3-carbonyl]benzoate |
| SMILES | CCn1c2ccc(C(=O)c3ccccc3C(=O)OCC(F)(F)C(F)F)cc2c2cc(C(=O)c3ccccc3C(=O)OCC(F)(F)C(F)F)ccc21 |
| InChI | InChI=1S/C36H25F8NO6/c1-2-45-27-13-11-19(29(46)21-7-3-5-9-23(21)31(48)50-17-35(41,42)33(37)38)15-25(27)26-16-20(12-14-28(26)45)30(47)22-8-4-6-10-24(22)32(49)51-18-36(43,44)34(39)40/h3-16,33-34H,2,17-18H2,1H3 |
| InChIKey | WGUGLVUTJTVRGV-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.58 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|