C35H50N4O5S2 — CID 155429218
(4S)-N-[3-(tert-butylsulfamoyl)-4-[2-[4-(propan-2-yloxymethoxymethylamino)cyclohexyl]-1,3-thiazol-5-yl]phenyl]-4-phenylpentanamide (PubChem CID 155429218) has the molecular formula C35H50N4O5S2 and a molecular weight of 670.94 g/mol. Its IUPAC name is (4S)-N-[3-(tert-butylsulfamoyl)-4-[2-[4-(propan-2-yloxymethoxymethylamino)cyclohexyl]-1,3-thiazol-5-yl]phenyl]-4-phenylpentanamide.
| Compound Name | (4S)-N-[3-(tert-butylsulfamoyl)-4-[2-[4-(propan-2-yloxymethoxymethylamino)cyclohexyl]-1,3-thiazol-5-yl]phenyl]-4-phenylpentanamide |
|---|---|
| PubChem CID | 155429218 |
| Molecular Formula | C35H50N4O5S2 |
| Molecular Weight | 670.94 g/mol |
| Exact Mass | 670.32 |
| IUPAC Name | (4S)-N-[3-(tert-butylsulfamoyl)-4-[2-[4-(propan-2-yloxymethoxymethylamino)cyclohexyl]-1,3-thiazol-5-yl]phenyl]-4-phenylpentanamide |
| SMILES | CC(C)OCOCNC1CCC(c2ncc(-c3ccc(NC(=O)CC[C@H](C)c4ccccc4)cc3S(=O)(=O)NC(C)(C)C)s2)CC1 |
| InChI | InChI=1S/C35H50N4O5S2/c1-24(2)44-23-43-22-37-28-15-13-27(14-16-28)34-36-21-31(45-34)30-18-17-29(20-32(30)46(41,42)39-35(4,5)6)38-33(40)19-12-25(3)26-10-8-7-9-11-26/h7-11,17-18,20-21,24-25,27-28,37,39H,12-16,19,22-23H2,1-6H3,(H,38,40)/t25-,27?,28?/m0/s1 |
| InChIKey | NTXILKLXDDGUFG-KBHDRSMZSA-N |
| XLogP | 7.38 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.94 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|