C32H31N7O5 — CID 155429461
4-[4-[[(12aS)-8-methoxy-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxy]butanoylamino]-N-(4-aminophenyl)-1-methylimidazole-2-carboxamide (PubChem CID 155429461) has the molecular formula C32H31N7O5 and a molecular weight of 593.64 g/mol. Its IUPAC name is 4-[4-[[(12aS)-8-methoxy-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxy]butanoylamino]-N-(4-aminophenyl)-1-methylimidazole-2-carboxamide.
| Compound Name | 4-[4-[[(12aS)-8-methoxy-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxy]butanoylamino]-N-(4-aminophenyl)-1-methylimidazole-2-carboxamide |
|---|---|
| PubChem CID | 155429461 |
| Molecular Formula | C32H31N7O5 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | 4-[4-[[(12aS)-8-methoxy-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxy]butanoylamino]-N-(4-aminophenyl)-1-methylimidazole-2-carboxamide |
| SMILES | COc1cc2c(cc1OCCCC(=O)Nc1cn(C)c(C(=O)Nc3ccc(N)cc3)n1)N=C[C@@H]1Cc3ccccc3N1C2=O |
| InChI | InChI=1S/C32H31N7O5/c1-38-18-28(37-30(38)31(41)35-21-11-9-20(33)10-12-21)36-29(40)8-5-13-44-27-16-24-23(15-26(27)43-2)32(42)39-22(17-34-24)14-19-6-3-4-7-25(19)39/h3-4,6-7,9-12,15-18,22H,5,8,13-14,33H2,1-2H3,(H,35,41)(H,36,40)/t22-/m0/s1 |
| InChIKey | MRRXLSVUUBZDNJ-QFIPXVFZSA-N |
| XLogP | 4.35 |
| TPSA | 153.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|