C41H45F4N5O3 — CID 155429866
(E)-N-cyclopentyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide (PubChem CID 155429866) has the molecular formula C41H45F4N5O3 and a molecular weight of 731.84 g/mol. Its IUPAC name is (E)-N-cyclopentyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide.
| Compound Name | (E)-N-cyclopentyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide |
|---|---|
| PubChem CID | 155429866 |
| Molecular Formula | C41H45F4N5O3 |
| Molecular Weight | 731.84 g/mol |
| Exact Mass | 731.35 |
| IUPAC Name | (E)-N-cyclopentyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide |
| SMILES | O=C(/C=C/CN1CCC[C@@H](Oc2ccc(/C(=C(/CC(F)(F)F)c3ccccc3)c3ccc4c(c3)c(F)nn4C3CCCCO3)cn2)C1)NC1CCCC1 |
| InChI | InChI=1S/C41H45F4N5O3/c42-40-33-24-29(17-19-35(33)50(48-40)38-16-6-7-23-52-38)39(34(25-41(43,44)45)28-10-2-1-3-11-28)30-18-20-37(46-26-30)53-32-14-8-21-49(27-32)22-9-15-36(51)47-31-12-4-5-13-31/h1-3,9-11,15,17-20,24,26,31-32,38H,4-8,12-14,16,21-23,25,27H2,(H,47,51)/b15-9+,39-34-/t32-,38?/m1/s1 |
| InChIKey | OJFBEDNZRNBPKM-YHTNTZBFSA-N |
| XLogP | 8.64 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.84 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|