C36H37F4N5O3 — CID 155429901
(E)-N-(oxan-4-yl)-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide (PubChem CID 155429901) has the molecular formula C36H37F4N5O3 and a molecular weight of 663.72 g/mol. Its IUPAC name is (E)-N-(oxan-4-yl)-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide.
| Compound Name | (E)-N-(oxan-4-yl)-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide |
|---|---|
| PubChem CID | 155429901 |
| Molecular Formula | C36H37F4N5O3 |
| Molecular Weight | 663.72 g/mol |
| Exact Mass | 663.28 |
| IUPAC Name | (E)-N-(oxan-4-yl)-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide |
| SMILES | O=C(/C=C/CN1CCC[C@@H](Oc2ccc(/C(=C(/CC(F)(F)F)c3ccccc3)c3ccc4n[nH]c(F)c4c3)cn2)C1)NC1CCOCC1 |
| InChI | InChI=1S/C36H37F4N5O3/c37-35-29-20-25(10-12-31(29)43-44-35)34(30(21-36(38,39)40)24-6-2-1-3-7-24)26-11-13-33(41-22-26)48-28-8-4-16-45(23-28)17-5-9-32(46)42-27-14-18-47-19-15-27/h1-3,5-7,9-13,20,22,27-28H,4,8,14-19,21,23H2,(H,42,46)(H,43,44)/b9-5+,34-30-/t28-/m1/s1 |
| InChIKey | VEGFPFSHHTWQER-QQSOVHRYSA-N |
| XLogP | 6.70 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.72 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|