C35H37F4N5O2 — CID 155429909
(E)-N-tert-butyl-4-[3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide (PubChem CID 155429909) has the molecular formula C35H37F4N5O2 and a molecular weight of 635.71 g/mol. Its IUPAC name is (E)-N-tert-butyl-4-[3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide.
| Compound Name | (E)-N-tert-butyl-4-[3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide |
|---|---|
| PubChem CID | 155429909 |
| Molecular Formula | C35H37F4N5O2 |
| Molecular Weight | 635.71 g/mol |
| Exact Mass | 635.29 |
| IUPAC Name | (E)-N-tert-butyl-4-[3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide |
| SMILES | CC(C)(C)NC(=O)/C=C/CN1CCCC(Oc2ccc(/C(=C(/CC(F)(F)F)c3ccccc3)c3ccc4n[nH]c(F)c4c3)cn2)C1 |
| InChI | InChI=1S/C35H37F4N5O2/c1-34(2,3)41-30(45)12-8-18-44-17-7-11-26(22-44)46-31-16-14-25(21-40-31)32(24-13-15-29-27(19-24)33(36)43-42-29)28(20-35(37,38)39)23-9-5-4-6-10-23/h4-6,8-10,12-16,19,21,26H,7,11,17-18,20,22H2,1-3H3,(H,41,45)(H,42,43)/b12-8+,32-28- |
| InChIKey | ZSCHWIDGVUHDPG-HIOPQZIKSA-N |
| XLogP | 7.32 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.71 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|