C32H31F4N5O2 — CID 155429920
(E)-N,N-dimethyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]pyrrolidin-1-yl]but-2-enamide (PubChem CID 155429920) has the molecular formula C32H31F4N5O2 and a molecular weight of 593.63 g/mol. Its IUPAC name is (E)-N,N-dimethyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]pyrrolidin-1-yl]but-2-enamide.
| Compound Name | (E)-N,N-dimethyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]pyrrolidin-1-yl]but-2-enamide |
|---|---|
| PubChem CID | 155429920 |
| Molecular Formula | C32H31F4N5O2 |
| Molecular Weight | 593.63 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | (E)-N,N-dimethyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]pyrrolidin-1-yl]but-2-enamide |
| SMILES | CN(C)C(=O)/C=C/CN1CC[C@@H](Oc2ccc(/C(=C(/CC(F)(F)F)c3ccccc3)c3ccc4n[nH]c(F)c4c3)cn2)C1 |
| InChI | InChI=1S/C32H31F4N5O2/c1-40(2)29(42)9-6-15-41-16-14-24(20-41)43-28-13-11-23(19-37-28)30(22-10-12-27-25(17-22)31(33)39-38-27)26(18-32(34,35)36)21-7-4-3-5-8-21/h3-13,17,19,24H,14-16,18,20H2,1-2H3,(H,38,39)/b9-6+,30-26-/t24-/m1/s1 |
| InChIKey | QYYZNVMRFSQWKT-RFYXUFKISA-N |
| XLogP | 6.11 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.63 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|