C30H26F4N4O2 — CID 155429925
1-[4-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]prop-2-en-1-one (PubChem CID 155429925) has the molecular formula C30H26F4N4O2 and a molecular weight of 550.56 g/mol. Its IUPAC name is 1-[4-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155429925 |
| Molecular Formula | C30H26F4N4O2 |
| Molecular Weight | 550.56 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | 1-[4-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Oc2ccc(/C(=C(/CC(F)(F)F)c3ccccc3)c3ccc4n[nH]c(F)c4c3)cn2)CC1 |
| InChI | InChI=1S/C30H26F4N4O2/c1-2-27(39)38-14-12-22(13-15-38)40-26-11-9-21(18-35-26)28(20-8-10-25-23(16-20)29(31)37-36-25)24(17-30(32,33)34)19-6-4-3-5-7-19/h2-11,16,18,22H,1,12-15,17H2,(H,36,37)/b28-24- |
| InChIKey | RKGGBEQAUQDLLL-COOPMVRXSA-N |
| XLogP | 6.56 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.56 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|