About 1-morpholin-4-ylethanone
1-morpholin-4-ylethanone (PubChem CID 15543) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is 1-morpholin-4-ylethanone.
Molecular Properties
| Compound Name | 1-morpholin-4-ylethanone |
| PubChem CID | 15543 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 1-morpholin-4-ylethanone |
| SMILES | CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C6H11NO2/c1-6(8)7-2-4-9-5-3-7/h2-5H2,1H3 |
| InChIKey | KYWXRBNOYGGPIZ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-morpholin-4-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-ylethanone?
The IUPAC name of 1-morpholin-4-ylethanone (CID 15543) is 1-morpholin-4-ylethanone.
What is the SMILES notation for 1-morpholin-4-ylethanone?
The canonical SMILES for 1-morpholin-4-ylethanone is CC(=O)N1CCOCC1.
What is the InChIKey of 1-morpholin-4-ylethanone?
The InChIKey is KYWXRBNOYGGPIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c1-6(8)7-2-4-9-5-3-7/h2-5H2,1H3.
What are the key properties of 1-morpholin-4-ylethanone?
1-morpholin-4-ylethanone has a molecular weight of 129.16 g/mol, XLogP of -0.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-ylethanone is sourced from PubChem (CID 15543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).