C42H39NO2 — CID 155430014
2-[[9,9-di(propan-2-yl)-10-(2,4,6-trimethylphenyl)acridin-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 155430014) has the molecular formula C42H39NO2 and a molecular weight of 589.78 g/mol. Its IUPAC name is 2-[[9,9-di(propan-2-yl)-10-(2,4,6-trimethylphenyl)acridin-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[9,9-di(propan-2-yl)-10-(2,4,6-trimethylphenyl)acridin-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 155430014 |
| Molecular Formula | C42H39NO2 |
| Molecular Weight | 589.78 g/mol |
| Exact Mass | 589.30 |
| IUPAC Name | 2-[[9,9-di(propan-2-yl)-10-(2,4,6-trimethylphenyl)acridin-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | Cc1cc(C)c(N2c3ccccc3C(C(C)C)(C(C)C)c3cc(C=C4C(=O)c5cc6ccccc6cc5C4=O)ccc32)c(C)c1 |
| InChI | InChI=1S/C42H39NO2/c1-24(2)42(25(3)4)35-14-10-11-15-37(35)43(39-27(6)18-26(5)19-28(39)7)38-17-16-29(21-36(38)42)20-34-40(44)32-22-30-12-8-9-13-31(30)23-33(32)41(34)45/h8-25H,1-7H3 |
| InChIKey | JVDVCQASCJQZAQ-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.78 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|