C41H45F4N5O4 — CID 155430040
(E)-N-(oxan-4-yl)-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide (PubChem CID 155430040) has the molecular formula C41H45F4N5O4 and a molecular weight of 747.83 g/mol. Its IUPAC name is (E)-N-(oxan-4-yl)-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide.
| Compound Name | (E)-N-(oxan-4-yl)-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide |
|---|---|
| PubChem CID | 155430040 |
| Molecular Formula | C41H45F4N5O4 |
| Molecular Weight | 747.83 g/mol |
| Exact Mass | 747.34 |
| IUPAC Name | (E)-N-(oxan-4-yl)-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide |
| SMILES | O=C(/C=C/CN1CCC[C@@H](Oc2ccc(/C(=C(/CC(F)(F)F)c3ccccc3)c3ccc4c(c3)c(F)nn4C3CCCCO3)cn2)C1)NC1CCOCC1 |
| InChI | InChI=1S/C41H45F4N5O4/c42-40-33-24-29(13-15-35(33)50(48-40)38-12-4-5-21-53-38)39(34(25-41(43,44)45)28-8-2-1-3-9-28)30-14-16-37(46-26-30)54-32-10-6-19-49(27-32)20-7-11-36(51)47-31-17-22-52-23-18-31/h1-3,7-9,11,13-16,24,26,31-32,38H,4-6,10,12,17-23,25,27H2,(H,47,51)/b11-7+,39-34-/t32-,38?/m1/s1 |
| InChIKey | VYFZZDIPJFYUJZ-AMIYFQAWSA-N |
| XLogP | 7.88 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.83 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|