C40H43F4N5O4 — CID 155430055
(E)-1-morpholin-4-yl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-en-1-one (PubChem CID 155430055) has the molecular formula C40H43F4N5O4 and a molecular weight of 733.81 g/mol. Its IUPAC name is (E)-1-morpholin-4-yl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-en-1-one.
| Compound Name | (E)-1-morpholin-4-yl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 155430055 |
| Molecular Formula | C40H43F4N5O4 |
| Molecular Weight | 733.81 g/mol |
| Exact Mass | 733.33 |
| IUPAC Name | (E)-1-morpholin-4-yl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-en-1-one |
| SMILES | O=C(/C=C/CN1CCC[C@@H](Oc2ccc(/C(=C(/CC(F)(F)F)c3ccccc3)c3ccc4c(c3)c(F)nn4C3CCCCO3)cn2)C1)N1CCOCC1 |
| InChI | InChI=1S/C40H43F4N5O4/c41-39-32-24-29(13-15-34(32)49(46-39)37-12-4-5-21-52-37)38(33(25-40(42,43)44)28-8-2-1-3-9-28)30-14-16-35(45-26-30)53-31-10-6-17-47(27-31)18-7-11-36(50)48-19-22-51-23-20-48/h1-3,7-9,11,13-16,24,26,31,37H,4-6,10,12,17-23,25,27H2/b11-7+,38-33-/t31-,37?/m1/s1 |
| InChIKey | RRICKDWSKJYOMS-CHTZNJIPSA-N |
| XLogP | 7.44 |
| TPSA | 81.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.81 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|