C35H35F4N5O3 — CID 155430359
(E)-1-morpholin-4-yl-4-[3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-en-1-one (PubChem CID 155430359) has the molecular formula C35H35F4N5O3 and a molecular weight of 649.69 g/mol. Its IUPAC name is (E)-1-morpholin-4-yl-4-[3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-en-1-one.
| Compound Name | (E)-1-morpholin-4-yl-4-[3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 155430359 |
| Molecular Formula | C35H35F4N5O3 |
| Molecular Weight | 649.69 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | (E)-1-morpholin-4-yl-4-[3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-en-1-one |
| SMILES | O=C(/C=C/CN1CCCC(Oc2ccc(/C(=C(/CC(F)(F)F)c3ccccc3)c3ccc4n[nH]c(F)c4c3)cn2)C1)N1CCOCC1 |
| InChI | InChI=1S/C35H35F4N5O3/c36-34-28-20-25(10-12-30(28)41-42-34)33(29(21-35(37,38)39)24-6-2-1-3-7-24)26-11-13-31(40-22-26)47-27-8-4-14-43(23-27)15-5-9-32(45)44-16-18-46-19-17-44/h1-3,5-7,9-13,20,22,27H,4,8,14-19,21,23H2,(H,41,42)/b9-5+,33-29- |
| InChIKey | VNHYPXVXSYIRNG-CWDBQZMHSA-N |
| XLogP | 6.27 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.69 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|