C24H19N5O4 — CID 155431250
4-(2-cyanophenyl)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-2-carboxamide (PubChem CID 155431250) has the molecular formula C24H19N5O4 and a molecular weight of 441.45 g/mol. Its IUPAC name is 4-(2-cyanophenyl)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | 4-(2-cyanophenyl)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155431250 |
| Molecular Formula | C24H19N5O4 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 4-(2-cyanophenyl)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
| SMILES | Cn1cc(-c2ccccc2C#N)c2cc(C(=O)NCc3ccc(C(=O)NO)cc3)[nH]c2c1=O |
| InChI | InChI=1S/C24H19N5O4/c1-29-13-19(17-5-3-2-4-16(17)11-25)18-10-20(27-21(18)24(29)32)23(31)26-12-14-6-8-15(9-7-14)22(30)28-33/h2-10,13,27,33H,12H2,1H3,(H,26,31)(H,28,30) |
| InChIKey | HSVPMLUIUUYNKU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 140.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|