C28H36N4O6 — CID 155431437
4-[2-cyclopropyloxy-5-(2-hydroxypropan-2-yl)phenyl]-N-[7-(hydroxyamino)-7-oxoheptyl]-6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-2-carboxamide (PubChem CID 155431437) has the molecular formula C28H36N4O6 and a molecular weight of 524.62 g/mol. Its IUPAC name is 4-[2-cyclopropyloxy-5-(2-hydroxypropan-2-yl)phenyl]-N-[7-(hydroxyamino)-7-oxoheptyl]-6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | 4-[2-cyclopropyloxy-5-(2-hydroxypropan-2-yl)phenyl]-N-[7-(hydroxyamino)-7-oxoheptyl]-6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155431437 |
| Molecular Formula | C28H36N4O6 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 4-[2-cyclopropyloxy-5-(2-hydroxypropan-2-yl)phenyl]-N-[7-(hydroxyamino)-7-oxoheptyl]-6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
| SMILES | Cn1cc(-c2cc(C(C)(C)O)ccc2OC2CC2)c2cc(C(=O)NCCCCCCC(=O)NO)[nH]c2c1=O |
| InChI | InChI=1S/C28H36N4O6/c1-28(2,36)17-9-12-23(38-18-10-11-18)19(14-17)21-16-32(3)27(35)25-20(21)15-22(30-25)26(34)29-13-7-5-4-6-8-24(33)31-37/h9,12,14-16,18,30,36-37H,4-8,10-11,13H2,1-3H3,(H,29,34)(H,31,33) |
| InChIKey | NQGWNAPGXNVYHS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 145.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|