C17H32N4 — CID 155431783
(7E)-N-(2-ethyliminoethyl)-N,2,2-trimethyl-1,4-diazacyclododeca-3,7-dien-7-amine (PubChem CID 155431783) has the molecular formula C17H32N4 and a molecular weight of 292.47 g/mol. Its IUPAC name is (7E)-N-(2-ethyliminoethyl)-N,2,2-trimethyl-1,4-diazacyclododeca-3,7-dien-7-amine.
| Compound Name | (7E)-N-(2-ethyliminoethyl)-N,2,2-trimethyl-1,4-diazacyclododeca-3,7-dien-7-amine |
|---|---|
| PubChem CID | 155431783 |
| Molecular Formula | C17H32N4 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | (7E)-N-(2-ethyliminoethyl)-N,2,2-trimethyl-1,4-diazacyclododeca-3,7-dien-7-amine |
| SMILES | CC/N=C/CN(C)/C1=C/CCCCNC(C)(C)/C=N/CC1 |
| InChI | InChI=1S/C17H32N4/c1-5-18-13-14-21(4)16-9-7-6-8-11-20-17(2,3)15-19-12-10-16/h9,13,15,20H,5-8,10-12,14H2,1-4H3/b16-9+,18-13+,19-15+ |
| InChIKey | HSBOEHMDQSVEKM-IMUIZJOESA-N |
| XLogP | 2.91 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|