C59H38F6N4 — CID 155432147
4-[3-[2-[3,5-bis(2-phenyl-4-pyridinyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-5-(2-phenyl-4-pyridinyl)phenyl]-2-phenylpyridine (PubChem CID 155432147) has the molecular formula C59H38F6N4 and a molecular weight of 916.97 g/mol. Its IUPAC name is 4-[3-[2-[3,5-bis(2-phenyl-4-pyridinyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-5-(2-phenyl-4-pyridinyl)phenyl]-2-phenylpyridine.
| Compound Name | 4-[3-[2-[3,5-bis(2-phenyl-4-pyridinyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-5-(2-phenyl-4-pyridinyl)phenyl]-2-phenylpyridine |
|---|---|
| PubChem CID | 155432147 |
| Molecular Formula | C59H38F6N4 |
| Molecular Weight | 916.97 g/mol |
| Exact Mass | 916.30 |
| IUPAC Name | 4-[3-[2-[3,5-bis(2-phenyl-4-pyridinyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-5-(2-phenyl-4-pyridinyl)phenyl]-2-phenylpyridine |
| SMILES | FC(F)(F)C(c1cc(-c2ccnc(-c3ccccc3)c2)cc(-c2ccnc(-c3ccccc3)c2)c1)(c1cc(-c2ccnc(-c3ccccc3)c2)cc(-c2ccnc(-c3ccccc3)c2)c1)C(F)(F)F |
| InChI | InChI=1S/C59H38F6N4/c60-58(61,62)57(59(63,64)65,51-31-47(43-21-25-66-53(35-43)39-13-5-1-6-14-39)29-48(32-51)44-22-26-67-54(36-44)40-15-7-2-8-16-40)52-33-49(45-23-27-68-55(37-45)41-17-9-3-10-18-41)30-50(34-52)46-24-28-69-56(38-46)42-19-11-4-12-20-42/h1-38H |
| InChIKey | CBLPFFCEBURFAU-UHFFFAOYSA-N |
| XLogP | 16.01 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.97 |
| LogP ≤ 5 | 16.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |