C34H25F8NO4 — CID 155432543
[9-ethyl-6-[2-(2,2,3,3-tetrafluoropropoxy)benzoyl]carbazol-3-yl]-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone (PubChem CID 155432543) has the molecular formula C34H25F8NO4 and a molecular weight of 663.56 g/mol. Its IUPAC name is [9-ethyl-6-[2-(2,2,3,3-tetrafluoropropoxy)benzoyl]carbazol-3-yl]-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone.
| Compound Name | [9-ethyl-6-[2-(2,2,3,3-tetrafluoropropoxy)benzoyl]carbazol-3-yl]-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 155432543 |
| Molecular Formula | C34H25F8NO4 |
| Molecular Weight | 663.56 g/mol |
| Exact Mass | 663.17 |
| IUPAC Name | [9-ethyl-6-[2-(2,2,3,3-tetrafluoropropoxy)benzoyl]carbazol-3-yl]-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone |
| SMILES | CCn1c2ccc(C(=O)c3ccc(OCC(F)(F)C(F)F)cc3)cc2c2cc(C(=O)c3ccccc3OCC(F)(F)C(F)F)ccc21 |
| InChI | InChI=1S/C34H25F8NO4/c1-2-43-26-13-9-20(29(44)19-7-11-22(12-8-19)46-17-33(39,40)31(35)36)15-24(26)25-16-21(10-14-27(25)43)30(45)23-5-3-4-6-28(23)47-18-34(41,42)32(37)38/h3-16,31-32H,2,17-18H2,1H3 |
| InChIKey | LHRUAUOXRFXLPC-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.56 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|