About N-methyl-N-propan-2-yl-3-propan-2-ylsulfanylhexa-1,5-dien-2-amine
N-methyl-N-propan-2-yl-3-propan-2-ylsulfanylhexa-1,5-dien-2-amine (PubChem CID 155432673) has the molecular formula C13H25NS
and a molecular weight of 227.42 g/mol. Its IUPAC name is N-methyl-N-propan-2-yl-3-propan-2-ylsulfanylhexa-1,5-dien-2-amine.
Molecular Properties
| Compound Name | N-methyl-N-propan-2-yl-3-propan-2-ylsulfanylhexa-1,5-dien-2-amine |
| PubChem CID | 155432673 |
| Molecular Formula | C13H25NS |
| Molecular Weight | 227.42 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | N-methyl-N-propan-2-yl-3-propan-2-ylsulfanylhexa-1,5-dien-2-amine |
| SMILES | C=CCC(SC(C)C)C(=C)N(C)C(C)C |
| InChI | InChI=1S/C13H25NS/c1-8-9-13(15-11(4)5)12(6)14(7)10(2)3/h8,10-11,13H,1,6,9H2,2-5,7H3 |
| InChIKey | PUWWJFSGSYAOOO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-propan-2-yl-3-propan-2-ylsulfanylhexa-1,5-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-propan-2-yl-3-propan-2-ylsulfanylhexa-1,5-dien-2-amine?
The IUPAC name of N-methyl-N-propan-2-yl-3-propan-2-ylsulfanylhexa-1,5-dien-2-amine (CID 155432673) is N-methyl-N-propan-2-yl-3-propan-2-ylsulfanylhexa-1,5-dien-2-amine.
What is the SMILES notation for N-methyl-N-propan-2-yl-3-propan-2-ylsulfanylhexa-1,5-dien-2-amine?
The canonical SMILES for N-methyl-N-propan-2-yl-3-propan-2-ylsulfanylhexa-1,5-dien-2-amine is C=CCC(SC(C)C)C(=C)N(C)C(C)C.
What is the InChIKey of N-methyl-N-propan-2-yl-3-propan-2-ylsulfanylhexa-1,5-dien-2-amine?
The InChIKey is PUWWJFSGSYAOOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NS/c1-8-9-13(15-11(4)5)12(6)14(7)10(2)3/h8,10-11,13H,1,6,9H2,2-5,7H3.
What are the key properties of N-methyl-N-propan-2-yl-3-propan-2-ylsulfanylhexa-1,5-dien-2-amine?
N-methyl-N-propan-2-yl-3-propan-2-ylsulfanylhexa-1,5-dien-2-amine has a molecular weight of 227.42 g/mol, XLogP of 3.93, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-propan-2-yl-3-propan-2-ylsulfanylhexa-1,5-dien-2-amine is sourced from PubChem (CID 155432673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).