About 2-methyl-2,3-dihydrothieno[3,4-b]furan
2-methyl-2,3-dihydrothieno[3,4-b]furan (PubChem CID 155432789) has the molecular formula C7H8OS
and a molecular weight of 140.21 g/mol. Its IUPAC name is 2-methyl-2,3-dihydrothieno[3,4-b]furan.
Molecular Properties
| Compound Name | 2-methyl-2,3-dihydrothieno[3,4-b]furan |
| PubChem CID | 155432789 |
| Molecular Formula | C7H8OS |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.03 |
| IUPAC Name | 2-methyl-2,3-dihydrothieno[3,4-b]furan |
| SMILES | CC1Cc2cscc2O1 |
| InChI | InChI=1S/C7H8OS/c1-5-2-6-3-9-4-7(6)8-5/h3-5H,2H2,1H3 |
| InChIKey | SDLFFWNKXKWHFS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-2,3-dihydrothieno[3,4-b]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,3-dihydrothieno[3,4-b]furan?
The IUPAC name of 2-methyl-2,3-dihydrothieno[3,4-b]furan (CID 155432789) is 2-methyl-2,3-dihydrothieno[3,4-b]furan.
What is the SMILES notation for 2-methyl-2,3-dihydrothieno[3,4-b]furan?
The canonical SMILES for 2-methyl-2,3-dihydrothieno[3,4-b]furan is CC1Cc2cscc2O1.
What is the InChIKey of 2-methyl-2,3-dihydrothieno[3,4-b]furan?
The InChIKey is SDLFFWNKXKWHFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8OS/c1-5-2-6-3-9-4-7(6)8-5/h3-5H,2H2,1H3.
What are the key properties of 2-methyl-2,3-dihydrothieno[3,4-b]furan?
2-methyl-2,3-dihydrothieno[3,4-b]furan has a molecular weight of 140.21 g/mol, XLogP of 2.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,3-dihydrothieno[3,4-b]furan is sourced from PubChem (CID 155432789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).