C19H21N3O7 — CID 155433259
2-hydroxypropane-1,2,3-tricarboxylic acid;(1S,12R)-5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene (PubChem CID 155433259) has the molecular formula C19H21N3O7 and a molecular weight of 403.39 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;(1S,12R)-5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;(1S,12R)-5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene |
|---|---|
| PubChem CID | 155433259 |
| Molecular Formula | C19H21N3O7 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;(1S,12R)-5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.c1cnc2cc3c(cc2n1)[C@@H]1CNC[C@H]3C1 |
| InChI | InChI=1S/C13H13N3.C6H8O7/c1-2-16-13-5-11-9-3-8(6-14-7-9)10(11)4-12(13)15-1;7-3(8)1-6(13,5(11)12)2-4(9)10/h1-2,4-5,8-9,14H,3,6-7H2;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t8-,9+; |
| InChIKey | CRRNHPYRGHDVNQ-UFIFRZAQSA-N |
| XLogP | 0.56 |
| TPSA | 169.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |