C17H13F3N2O2 — CID 155433544
8-oxo-N-[(2,3,4-trifluorophenyl)methyl]-6,7-dihydro-5H-quinoline-5-carboxamide (PubChem CID 155433544) has the molecular formula C17H13F3N2O2 and a molecular weight of 334.30 g/mol. Its IUPAC name is 8-oxo-N-[(2,3,4-trifluorophenyl)methyl]-6,7-dihydro-5H-quinoline-5-carboxamide.
| Compound Name | 8-oxo-N-[(2,3,4-trifluorophenyl)methyl]-6,7-dihydro-5H-quinoline-5-carboxamide |
|---|---|
| PubChem CID | 155433544 |
| Molecular Formula | C17H13F3N2O2 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 8-oxo-N-[(2,3,4-trifluorophenyl)methyl]-6,7-dihydro-5H-quinoline-5-carboxamide |
| SMILES | O=C1CCC(C(=O)NCc2ccc(F)c(F)c2F)c2cccnc21 |
| InChI | InChI=1S/C17H13F3N2O2/c18-12-5-3-9(14(19)15(12)20)8-22-17(24)11-4-6-13(23)16-10(11)2-1-7-21-16/h1-3,5,7,11H,4,6,8H2,(H,22,24) |
| InChIKey | IEQUMDVBVUXFBQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|